CAS 13240-18-1 appears in our catalog under these names: (2,5-Dimethyl-benzenesulfonylamino)-acetic acid, 98%, (2,5-Dimethyl-benzenesulfonylamino)-aceticacid, 97%, (2,5-DIMETHYL-BENZENESULFONYLAMINO)-ACETIC ACID, 97%, 97%, (2,5-Dimethyl-benzenesulfonylamino)-acetic acid, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 2.5g.
2-[(2,5-dimethylphenyl)sulfonylamino]acetic acid (CAS 13240-18-1) is a chemical compound with the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. IUPAC name: 2-[(2,5-dimethylphenyl)sulfonylamino]acetic acid. InChIKey: LQBDYUYIAIGJGX-UHFFFAOYSA-N.
| Molecular formula | C10H13NO4S |
|---|---|
| Molecular weight | 243.28 g/mol |
| IUPAC name | 2-[(2,5-dimethylphenyl)sulfonylamino]acetic acid |
| InChIKey | LQBDYUYIAIGJGX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)S(=O)(=O)NCC(=O)O |
Computed by PubChem (NCBI)