CAS 13241-36-6 appears in our catalog under these names: Isosorbide Impurity 15, (3aS,6aS)–dihydrofuro(3,2–b)furan–3,6(2H,5H)–dione. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 1g, 250mg.
(3aS,6aS)-3a,6a-dihydrofuro[3,2-b]furan-3,6-dione (CAS 13241-36-6) is a chemical compound with the molecular formula C6H6O4 and a molecular weight of 142.11 g/mol. IUPAC name: (3aS,6aS)-3a,6a-dihydrofuro[3,2-b]furan-3,6-dione. InChIKey: WDUVHBUZEIBPBR-PHDIDXHHSA-N.
| Molecular formula | C6H6O4 |
|---|---|
| Molecular weight | 142.11 g/mol |
| IUPAC name | (3aS,6aS)-3a,6a-dihydrofuro[3,2-b]furan-3,6-dione |
| InChIKey | WDUVHBUZEIBPBR-PHDIDXHHSA-N |
| SMILES | C1C(=O)[C@@H]2[C@H](O1)C(=O)CO2 |
Computed by PubChem (NCBI)