Products 34867-87-3

CAS 34867-87-3 is the registry number for Cyclobutane malonyl peroxide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

6,7-dioxaspiro[3.4]octane-5,8-dione (CAS 34867-87-3) is a chemical compound with the molecular formula C6H6O4 and a molecular weight of 142.11 g/mol. IUPAC name: 6,7-dioxaspiro[3.4]octane-5,8-dione. InChIKey: BSQQTMMSCSSKST-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6O4
Molecular weight142.11 g/mol
IUPAC name6,7-dioxaspiro[3.4]octane-5,8-dione
InChIKeyBSQQTMMSCSSKST-UHFFFAOYSA-N
SMILESC1CC2(C1)C(=O)OOC2=O

Computed by PubChem (NCBI)