CAS 13249-58-6 is the registry number for (2-Bromoethene-1,1-diyl)dibenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2-bromo-1-phenylethenyl)benzene (CAS 13249-58-6) is a chemical compound with the molecular formula C14H11Br and a molecular weight of 259.14 g/mol. IUPAC name: (2-bromo-1-phenylethenyl)benzene. InChIKey: QRDVTIMUEDYLOC-UHFFFAOYSA-N.
| Molecular formula | C14H11Br |
|---|---|
| Molecular weight | 259.14 g/mol |
| IUPAC name | (2-bromo-1-phenylethenyl)benzene |
| InChIKey | QRDVTIMUEDYLOC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=CBr)C2=CC=CC=C2 |
Computed by PubChem (NCBI)