CAS 4333-76-0 is the registry number for 1-Bromo-4-(1-phenylvinyl)benzene, 98%. Offered by: AmBeed. Available pack sizes: 5g.
1-bromo-4-(1-phenylethenyl)benzene (CAS 4333-76-0) is a chemical compound with the molecular formula C14H11Br and a molecular weight of 259.14 g/mol. IUPAC name: 1-bromo-4-(1-phenylethenyl)benzene. InChIKey: RFBNEESZDICKQI-UHFFFAOYSA-N.
| Molecular formula | C14H11Br |
|---|---|
| Molecular weight | 259.14 g/mol |
| IUPAC name | 1-bromo-4-(1-phenylethenyl)benzene |
| InChIKey | RFBNEESZDICKQI-UHFFFAOYSA-N |
| SMILES | C=C(C1=CC=CC=C1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)