CAS 132523-94-5 appears in our catalog under these names: Thymine-alpha,alpha,alpha,6-d4 Glycol (mixture of diastereomers), 98 atom % D, min 98% Chemical Purity, Thymine-α,α,α,6-d4 Glycol (mixture of diastereomers)-d4. Offered by: CDN, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 1 mg.
6-deuterio-5,6-dihydroxy-5-(trideuteriomethyl)-1,3-diazinane-2,4-dione (CAS 132523-94-5) is a chemical compound with the molecular formula C5H8N2O4 and a molecular weight of 164.15 g/mol. IUPAC name: 6-deuterio-5,6-dihydroxy-5-(trideuteriomethyl)-1,3-diazinane-2,4-dione. InChIKey: GUKSGXOLJNWRLZ-MZCSYVLQSA-N.
| Molecular formula | C5H8N2O4 |
|---|---|
| Molecular weight | 164.15 g/mol |
| IUPAC name | 6-deuterio-5,6-dihydroxy-5-(trideuteriomethyl)-1,3-diazinane-2,4-dione |
| InChIKey | GUKSGXOLJNWRLZ-MZCSYVLQSA-N |
| SMILES | [2H]C1(C(C(=O)NC(=O)N1)(C([2H])([2H])[2H])O)O |
Computed by PubChem (NCBI)