CAS 2374-41-6 is the registry number for N-Formimino-L-aspartate. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-formimidoyl-L-aspartic acid is an aspartic acid derivative that is the N-formimidoyl derivative of L-aspartic acid. It has a role as a bacterial xenobiotic metabolite. It is a C4-dicarboxylic acid and a L-aspartic acid derivative. It is a conjugate acid of a N-formimidoyl-L-aspartate(2-) and a N-iminiumylmethyl-L-aspartate.
Source: ChEBI
| Molecular formula | C5H8N2O4 |
|---|---|
| Molecular weight | 160.13 g/mol |
| IUPAC name | (2S)-2-(aminomethylideneamino)butanedioic acid |
| InChIKey | XTPIFIMCFHNJOH-VKHMYHEASA-N |
| SMILES | C([C@@H](C(=O)O)N=CN)C(=O)O |
Computed by PubChem (NCBI)