CAS 132554-61-1 is the registry number for 2-Chloronaphthalene-1,3-dicarbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-chloronaphthalene-1,3-dicarbaldehyde (CAS 132554-61-1) is a chemical compound with the molecular formula C12H7ClO2 and a molecular weight of 218.63 g/mol. IUPAC name: 2-chloronaphthalene-1,3-dicarbaldehyde. InChIKey: JOYGBOVLNGIRHD-UHFFFAOYSA-N.
| Molecular formula | C12H7ClO2 |
|---|---|
| Molecular weight | 218.63 g/mol |
| IUPAC name | 2-chloronaphthalene-1,3-dicarbaldehyde |
| InChIKey | JOYGBOVLNGIRHD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=C2C=O)Cl)C=O |
Computed by PubChem (NCBI)