CAS 20307-43-1 is the registry number for 4'-Chloro-[1,1'-biphenyl]-2,5-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-chlorophenyl)cyclohexa-2,5-diene-1,4-dione (CAS 20307-43-1) is a chemical compound with the molecular formula C12H7ClO2 and a molecular weight of 218.63 g/mol. IUPAC name: 2-(4-chlorophenyl)cyclohexa-2,5-diene-1,4-dione. InChIKey: ZYZNNQZZYJAPLH-UHFFFAOYSA-N.
| Molecular formula | C12H7ClO2 |
|---|---|
| Molecular weight | 218.63 g/mol |
| IUPAC name | 2-(4-chlorophenyl)cyclohexa-2,5-diene-1,4-dione |
| InChIKey | ZYZNNQZZYJAPLH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=O)C=CC2=O)Cl |
Computed by PubChem (NCBI)