CAS 1325808-64-7 appears in our catalog under these names: Niclosamide-13C6, Niclosamide–13C6, Niclosamide-13C6, 99%, 99%, Niclosamide-13C6, 99.0%, 13C6-Niclosamide. Offered by: Hubei YoungXin, TRC, GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg, 1 mg.
5-chloro-N-(2-chloro-4-nitro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-2-hydroxybenzamide (CAS 1325808-64-7) is a chemical compound with the molecular formula C13H8Cl2N2O4 and a molecular weight of 333.07 g/mol. IUPAC name: 5-chloro-N-(2-chloro-4-nitro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-2-hydroxybenzamide. InChIKey: RJMUSRYZPJIFPJ-WWNCZKIWSA-N.
| Molecular formula | C13H8Cl2N2O4 |
|---|---|
| Molecular weight | 333.07 g/mol |
| IUPAC name | 5-chloro-N-(2-chloro-4-nitro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-2-hydroxybenzamide |
| InChIKey | RJMUSRYZPJIFPJ-WWNCZKIWSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)N[13C]2=[13C]([13CH]=[13C]([13CH]=[13CH]2)[N+](=O)[O-])Cl)O |
Computed by PubChem (NCBI)