Products 2648939-40-4
CAS 2648939-40-4 is the registry number for Thalidomide-5,6-Cl. Offered by: MedChemExpress. Available pack sizes: Get quote.
5,6-dichloro-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (CAS 2648939-40-4) is a chemical compound with the molecular formula C13H8Cl2N2O4 and a molecular weight of 327.12 g/mol. IUPAC name: 5,6-dichloro-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione. InChIKey: CRUZGGVJWKEBLC-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2N2O4 |
|---|---|
| Molecular weight | 327.12 g/mol |
| IUPAC name | 5,6-dichloro-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| InChIKey | CRUZGGVJWKEBLC-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=CC(=C(C=C3C2=O)Cl)Cl |
Computed by PubChem (NCBI)