CAS 132588-91-1 appears in our catalog under these names: 2,2-Dimethyl-2,3-dihydroquinolin-4(1H)-one, 97%, 2,2-Dimethyl-2,3-dihydro-1H-quinolin-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,2-dimethyl-1,3-dihydroquinolin-4-one (CAS 132588-91-1) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 2,2-dimethyl-1,3-dihydroquinolin-4-one. InChIKey: RWVLKDAXCNBLPV-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 2,2-dimethyl-1,3-dihydroquinolin-4-one |
| InChIKey | RWVLKDAXCNBLPV-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C2=CC=CC=C2N1)C |
Computed by PubChem (NCBI)