Products 132605-98-2

CAS 132605-98-2 appears in our catalog under these names: (R)–3–Amino–2–methylpropanoic acid hydrochloride, (R)-3-Amino-2-methylpropanoic acid hydrochloride, (R)-3-Amino-2-methylpropanoic acid hydrochloride, 95%, (R)-3-Amino-2-methylpropanoic acid hydro, chloride, 100 mg, (R)-3-amino-2-methylpropanoic acid hydrochloride, 97%, 97%. Offered by: GLPBio, Biosynth, Combi-blocks, Fluorochem, Roth. Available pack sizes: 100mg, 10mg, 50mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(2R)-3-amino-2-methylpropanoic acid;hydrochloride (CAS 132605-98-2) is a chemical compound with the molecular formula C4H10ClNO2 and a molecular weight of 139.58 g/mol. IUPAC name: (2R)-3-amino-2-methylpropanoic acid;hydrochloride. InChIKey: CGGBOMJVYQTWRN-AENDTGMFSA-N.

Identity
Molecular formulaC4H10ClNO2
Molecular weight139.58 g/mol
IUPAC name(2R)-3-amino-2-methylpropanoic acid;hydrochloride
InChIKeyCGGBOMJVYQTWRN-AENDTGMFSA-N
SMILESC[C@H](CN)C(=O)O.Cl

Computed by PubChem (NCBI)