Products 1346602-62-7
CAS 1346602-62-7 appears in our catalog under these names: rac-3-Aminoisobutyric Acid-d3 Hydrochloride, >95% (HPLC), Rac–3–Aminoisobutyric Acid–d3 Hydrochloride, 3-Aminoisobutyric acid-d3 (hydrochloride), 99.98%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 50mg, 5mg, 5 mg.
2-(aminomethyl)-3,3,3-trideuteriopropanoic acid;hydrochloride (CAS 1346602-62-7) is a chemical compound with the molecular formula C4H10ClNO2 and a molecular weight of 142.60 g/mol. IUPAC name: 2-(aminomethyl)-3,3,3-trideuteriopropanoic acid;hydrochloride. InChIKey: CGGBOMJVYQTWRN-NIIDSAIPSA-N.
| Molecular formula | C4H10ClNO2 |
|---|---|
| Molecular weight | 142.60 g/mol |
| IUPAC name | 2-(aminomethyl)-3,3,3-trideuteriopropanoic acid;hydrochloride |
| InChIKey | CGGBOMJVYQTWRN-NIIDSAIPSA-N |
| SMILES | [2H]C([2H])([2H])C(CN)C(=O)O.Cl |
Computed by PubChem (NCBI)