CAS 13261-63-7 appears in our catalog under these names: 9H-Fluorene-2,7-diamine, n2,n2,n7,n7-tetramethyl-, 95%, N2,N2,N7,N7–Tetramethyl–9H–fluorene–2,7–diamine, 9H-Fluorene-2,7-diamine,N,N,N',N'-tetramethyl-, N2,N2,N7,N7-TETRAMETHYL-9H-FLUORENE-2,7-DIAMINE, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
2-N,2-N,7-N,7-N-tetramethyl-9H-fluorene-2,7-diamine (CAS 13261-63-7) is a chemical compound with the molecular formula C17H20N2 and a molecular weight of 252.35 g/mol. IUPAC name: 2-N,2-N,7-N,7-N-tetramethyl-9H-fluorene-2,7-diamine. InChIKey: PBWSLSWOCDRPKX-UHFFFAOYSA-N.
| Molecular formula | C17H20N2 |
|---|---|
| Molecular weight | 252.35 g/mol |
| IUPAC name | 2-N,2-N,7-N,7-N-tetramethyl-9H-fluorene-2,7-diamine |
| InChIKey | PBWSLSWOCDRPKX-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)C3=C(C2)C=C(C=C3)N(C)C |
Computed by PubChem (NCBI)