CAS 832155-10-9 is the registry number for (R)-1-Benzyl-3-phenylpiperazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R)-1-benzyl-3-phenylpiperazine (CAS 832155-10-9) is a chemical compound with the molecular formula C17H20N2 and a molecular weight of 252.35 g/mol. IUPAC name: (3R)-1-benzyl-3-phenylpiperazine. InChIKey: KMOQMXILLUBOJL-KRWDZBQOSA-N.
| Molecular formula | C17H20N2 |
|---|---|
| Molecular weight | 252.35 g/mol |
| IUPAC name | (3R)-1-benzyl-3-phenylpiperazine |
| InChIKey | KMOQMXILLUBOJL-KRWDZBQOSA-N |
| SMILES | C1CN(C[C@H](N1)C2=CC=CC=C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)