CAS 1326809-75-9 is the registry number for 4-([1,1'-Biphenyl]-4-carbonyl)-8-(tert-butyl)-1-oxa-4-azaspiro[4.5]decane-3-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
8-tert-butyl-4-(4-phenylbenzoyl)-1-oxa-4-azaspiro[4.5]decane-3-carboxylic acid (CAS 1326809-75-9) is a chemical compound with the molecular formula C26H31NO4 and a molecular weight of 421.5 g/mol. IUPAC name: 8-tert-butyl-4-(4-phenylbenzoyl)-1-oxa-4-azaspiro[4.5]decane-3-carboxylic acid. InChIKey: PGODKOUPHFLYJO-UHFFFAOYSA-N.
| Molecular formula | C26H31NO4 |
|---|---|
| Molecular weight | 421.5 g/mol |
| IUPAC name | 8-tert-butyl-4-(4-phenylbenzoyl)-1-oxa-4-azaspiro[4.5]decane-3-carboxylic acid |
| InChIKey | PGODKOUPHFLYJO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CCC2(CC1)N(C(CO2)C(=O)O)C(=O)C3=CC=C(C=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)