Products 2350167-30-3

CAS 2350167-30-3 is the registry number for (R)-3-(Fmoc-amino)-5-cyclohexylpentanoic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

(3R)-5-cyclohexyl-3-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid (CAS 2350167-30-3) is a chemical compound with the molecular formula C26H31NO4 and a molecular weight of 421.5 g/mol. IUPAC name: (3R)-5-cyclohexyl-3-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid. InChIKey: DKDJBFBBLLZMRX-LJQANCHMSA-N.

Identity
Molecular formulaC26H31NO4
Molecular weight421.5 g/mol
IUPAC name(3R)-5-cyclohexyl-3-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid
InChIKeyDKDJBFBBLLZMRX-LJQANCHMSA-N
SMILESC1CCC(CC1)CC[C@H](CC(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24

Computed by PubChem (NCBI)