CAS 1326810-54-1 appears in our catalog under these names: ethyl 5-(3-fluoro-4-methoxyphenyl)-1H-pyrazole-3-carboxylate, 98%, 98%, ethyl 5-(3-fluoro-4-methoxyphenyl)-1H-pyrazole-3-carboxylate. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
Ethyl 3-(3-fluoro-4-methoxyphenyl)-1H-pyrazole-5-carboxylate (CAS 1326810-54-1) is a chemical compound with the molecular formula C13H13FN2O3 and a molecular weight of 264.25 g/mol. IUPAC name: ethyl 3-(3-fluoro-4-methoxyphenyl)-1H-pyrazole-5-carboxylate. InChIKey: BJEZFTYWXDPGBI-UHFFFAOYSA-N.
| Molecular formula | C13H13FN2O3 |
|---|---|
| Molecular weight | 264.25 g/mol |
| IUPAC name | ethyl 3-(3-fluoro-4-methoxyphenyl)-1H-pyrazole-5-carboxylate |
| InChIKey | BJEZFTYWXDPGBI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=NN1)C2=CC(=C(C=C2)OC)F |
Computed by PubChem (NCBI)