CAS 81024-49-9 is the registry number for 2-Acetamido-3-(6-fluoro-1H-indol-3-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg, 500mg.
2-acetamido-3-(6-fluoro-1H-indol-3-yl)propanoic acid (CAS 81024-49-9) is a chemical compound with the molecular formula C13H13FN2O3 and a molecular weight of 264.25 g/mol. IUPAC name: 2-acetamido-3-(6-fluoro-1H-indol-3-yl)propanoic acid. InChIKey: FOQOOWDYWORKME-UHFFFAOYSA-N.
| Molecular formula | C13H13FN2O3 |
|---|---|
| Molecular weight | 264.25 g/mol |
| IUPAC name | 2-acetamido-3-(6-fluoro-1H-indol-3-yl)propanoic acid |
| InChIKey | FOQOOWDYWORKME-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(CC1=CNC2=C1C=CC(=C2)F)C(=O)O |
Computed by PubChem (NCBI)