Products 81024-49-9

CAS 81024-49-9 is the registry number for 2-Acetamido-3-(6-fluoro-1H-indol-3-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

2-acetamido-3-(6-fluoro-1H-indol-3-yl)propanoic acid (CAS 81024-49-9) is a chemical compound with the molecular formula C13H13FN2O3 and a molecular weight of 264.25 g/mol. IUPAC name: 2-acetamido-3-(6-fluoro-1H-indol-3-yl)propanoic acid. InChIKey: FOQOOWDYWORKME-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13FN2O3
Molecular weight264.25 g/mol
IUPAC name2-acetamido-3-(6-fluoro-1H-indol-3-yl)propanoic acid
InChIKeyFOQOOWDYWORKME-UHFFFAOYSA-N
SMILESCC(=O)NC(CC1=CNC2=C1C=CC(=C2)F)C(=O)O

Computed by PubChem (NCBI)