CAS 1326814-32-7 appears in our catalog under these names: 3-Methylbenzyl carbamimidothioate hydrobromide, 97%, 2-(m-tolylmethyl)isothiourea,hydrobromide, 97%, 97%, {[(3-methylphenyl)methyl]sulfanyl}methanimidamide hydrobromide, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg, 500mg.
(3-methylphenyl)methyl carbamimidothioate;hydrobromide (CAS 1326814-32-7) is a chemical compound with the molecular formula C9H13BrN2S and a molecular weight of 261.18 g/mol. IUPAC name: (3-methylphenyl)methyl carbamimidothioate;hydrobromide. InChIKey: RFSISZUZFKKYAH-UHFFFAOYSA-N.
| Molecular formula | C9H13BrN2S |
|---|---|
| Molecular weight | 261.18 g/mol |
| IUPAC name | (3-methylphenyl)methyl carbamimidothioate;hydrobromide |
| InChIKey | RFSISZUZFKKYAH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)CSC(=N)N.Br |
Computed by PubChem (NCBI)