Products 72209-88-2

CAS 72209-88-2 is the registry number for 4-Methylbenzyl carbamimidothioate hydrobromide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(4-methylphenyl)methyl carbamimidothioate;hydrobromide (CAS 72209-88-2) is a chemical compound with the molecular formula C9H13BrN2S and a molecular weight of 261.18 g/mol. IUPAC name: (4-methylphenyl)methyl carbamimidothioate;hydrobromide. InChIKey: WIHRHRXUIGBOPJ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13BrN2S
Molecular weight261.18 g/mol
IUPAC name(4-methylphenyl)methyl carbamimidothioate;hydrobromide
InChIKeyWIHRHRXUIGBOPJ-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)CSC(=N)N.Br

Computed by PubChem (NCBI)