CAS 72209-88-2 is the registry number for 4-Methylbenzyl carbamimidothioate hydrobromide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-methylphenyl)methyl carbamimidothioate;hydrobromide (CAS 72209-88-2) is a chemical compound with the molecular formula C9H13BrN2S and a molecular weight of 261.18 g/mol. IUPAC name: (4-methylphenyl)methyl carbamimidothioate;hydrobromide. InChIKey: WIHRHRXUIGBOPJ-UHFFFAOYSA-N.
| Molecular formula | C9H13BrN2S |
|---|---|
| Molecular weight | 261.18 g/mol |
| IUPAC name | (4-methylphenyl)methyl carbamimidothioate;hydrobromide |
| InChIKey | WIHRHRXUIGBOPJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CSC(=N)N.Br |
Computed by PubChem (NCBI)