CAS 1326814-97-4 is the registry number for 3,4-Dichlorobenzyl carbamimidothioate hydrobromide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3,4-dichlorophenyl)methyl carbamimidothioate;hydrobromide (CAS 1326814-97-4) is a chemical compound with the molecular formula C8H9BrCl2N2S and a molecular weight of 316.04 g/mol. IUPAC name: (3,4-dichlorophenyl)methyl carbamimidothioate;hydrobromide. InChIKey: ADVIDHZZKKYFTB-UHFFFAOYSA-N.
| Molecular formula | C8H9BrCl2N2S |
|---|---|
| Molecular weight | 316.04 g/mol |
| IUPAC name | (3,4-dichlorophenyl)methyl carbamimidothioate;hydrobromide |
| InChIKey | ADVIDHZZKKYFTB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CSC(=N)N)Cl)Cl.Br |
Computed by PubChem (NCBI)