CAS 938156-42-4 is the registry number for {((2,5-dichlorophenyl)methyl)sulfanyl}methanimidamide hydrobromide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(2,5-dichlorophenyl)methyl carbamimidothioate;hydrobromide (CAS 938156-42-4) is a chemical compound with the molecular formula C8H9BrCl2N2S and a molecular weight of 316.04 g/mol. IUPAC name: (2,5-dichlorophenyl)methyl carbamimidothioate;hydrobromide. InChIKey: MGAPWXIJGKIWLV-UHFFFAOYSA-N.
| Molecular formula | C8H9BrCl2N2S |
|---|---|
| Molecular weight | 316.04 g/mol |
| IUPAC name | (2,5-dichlorophenyl)methyl carbamimidothioate;hydrobromide |
| InChIKey | MGAPWXIJGKIWLV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)CSC(=N)N)Cl.Br |
Computed by PubChem (NCBI)