Products 1326832-84-1
CAS 1326832-84-1 is the registry number for 4-(4-Fluorophenyl)-2-(3-methoxyphenyl)-1h-imidazole-5-thiol, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-(4-fluorophenyl)-2-(3-methoxyphenyl)-1H-imidazole-4-thiol (CAS 1326832-84-1) is a chemical compound with the molecular formula C16H13FN2OS and a molecular weight of 300.4 g/mol. IUPAC name: 5-(4-fluorophenyl)-2-(3-methoxyphenyl)-1H-imidazole-4-thiol. InChIKey: SWTTYFRYINLNSO-UHFFFAOYSA-N.
| Molecular formula | C16H13FN2OS |
|---|---|
| Molecular weight | 300.4 g/mol |
| IUPAC name | 5-(4-fluorophenyl)-2-(3-methoxyphenyl)-1H-imidazole-4-thiol |
| InChIKey | SWTTYFRYINLNSO-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=NC(=C(N2)C3=CC=C(C=C3)F)S |
Computed by PubChem (NCBI)