CAS 919035-95-3 is the registry number for 5-(4-Fluorophenyl)-1-(4-methoxyphenyl)-1H-imidazole-2(3H)-thione. Offered by: TRC. Available pack sizes: 500mg.
4-(4-fluorophenyl)-3-(4-methoxyphenyl)-1H-imidazole-2-thione (CAS 919035-95-3) is a chemical compound with the molecular formula C16H13FN2OS and a molecular weight of 300.4 g/mol. IUPAC name: 4-(4-fluorophenyl)-3-(4-methoxyphenyl)-1H-imidazole-2-thione. InChIKey: ZAXHNKJPLSNYDZ-UHFFFAOYSA-N.
| Molecular formula | C16H13FN2OS |
|---|---|
| Molecular weight | 300.4 g/mol |
| IUPAC name | 4-(4-fluorophenyl)-3-(4-methoxyphenyl)-1H-imidazole-2-thione |
| InChIKey | ZAXHNKJPLSNYDZ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N2C(=CNC2=S)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)