CAS 132685-67-7 appears in our catalog under these names: 1-{((2-bromophenyl)methylidene)amino}guanidine, 95%, 1-{((2-Bromophenyl)methylidene)amino}guanidine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-[(E)-(2-bromophenyl)methylideneamino]guanidine (CAS 132685-67-7) is a chemical compound with the molecular formula C8H9BrN4 and a molecular weight of 241.09 g/mol. IUPAC name: 2-[(E)-(2-bromophenyl)methylideneamino]guanidine. InChIKey: AVXKQDSMHJFZGZ-LFYBBSHMSA-N.
| Molecular formula | C8H9BrN4 |
|---|---|
| Molecular weight | 241.09 g/mol |
| IUPAC name | 2-[(E)-(2-bromophenyl)methylideneamino]guanidine |
| InChIKey | AVXKQDSMHJFZGZ-LFYBBSHMSA-N |
| SMILES | C1=CC=C(C(=C1)/C=N/N=C(N)N)Br |
Computed by PubChem (NCBI)