CAS 132715-70-9 appears in our catalog under these names: 2-Bromo-3-fluorobenzamide 97%, 2-Bromo-3-fluorobenzamide, 97%, 97%, Benzamide, 2-bromo-3-fluoro-, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-bromo-3-fluorobenzamide (CAS 132715-70-9) is a chemical compound with the molecular formula C7H5BrFNO and a molecular weight of 218.02 g/mol. IUPAC name: 2-bromo-3-fluorobenzamide. InChIKey: QIJLTAHMKMBLRZ-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO |
|---|---|
| Molecular weight | 218.02 g/mol |
| IUPAC name | 2-bromo-3-fluorobenzamide |
| InChIKey | QIJLTAHMKMBLRZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)Br)C(=O)N |
Computed by PubChem (NCBI)