Products 1327156-14-8
CAS 1327156-14-8 appears in our catalog under these names: (S)–S007–1558, (S)-S007-1558, 99.78%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 50 mg, 5 mg, 10 mg, 100 mg, 25 mg.
(3S)-2-(4-methoxyphenyl)sulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxamide (CAS 1327156-14-8) is a chemical compound with the molecular formula C19H19N3O4S and a molecular weight of 385.4 g/mol. IUPAC name: (3S)-2-(4-methoxyphenyl)sulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxamide. InChIKey: KBVPHVCPUVDXOQ-SFHVURJKSA-N.
| Molecular formula | C19H19N3O4S |
|---|---|
| Molecular weight | 385.4 g/mol |
| IUPAC name | (3S)-2-(4-methoxyphenyl)sulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxamide |
| InChIKey | KBVPHVCPUVDXOQ-SFHVURJKSA-N |
| SMILES | COC1=CC=C(C=C1)S(=O)(=O)N2CC3=C(C[C@H]2C(=O)N)C4=CC=CC=C4N3 |
Computed by PubChem (NCBI)