Products 727686-80-8
CAS 727686-80-8 appears in our catalog under these names: SKI–349, SKI-349, 99.58%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 10 mg, 25 mg, 50 mg, 5 mg.
[4-amino-2-(4-methoxyanilino)-1,3-thiazol-5-yl]-(3,4-dimethoxyphenyl)methanone (CAS 727686-80-8) is a chemical compound with the molecular formula C19H19N3O4S and a molecular weight of 385.4 g/mol. IUPAC name: [4-amino-2-(4-methoxyanilino)-1,3-thiazol-5-yl]-(3,4-dimethoxyphenyl)methanone. InChIKey: OWBQCPZBRPKYKE-UHFFFAOYSA-N.
| Molecular formula | C19H19N3O4S |
|---|---|
| Molecular weight | 385.4 g/mol |
| IUPAC name | [4-amino-2-(4-methoxyanilino)-1,3-thiazol-5-yl]-(3,4-dimethoxyphenyl)methanone |
| InChIKey | OWBQCPZBRPKYKE-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)NC2=NC(=C(S2)C(=O)C3=CC(=C(C=C3)OC)OC)N |
Computed by PubChem (NCBI)