CAS 13272-29-2 is the registry number for 3-(2-Bromoethyl)-5,5-dimethylimidazolidine-2,4-dione, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-(2-bromoethyl)-5,5-dimethylimidazolidine-2,4-dione (CAS 13272-29-2) is a chemical compound with the molecular formula C7H11BrN2O2 and a molecular weight of 235.08 g/mol. IUPAC name: 3-(2-bromoethyl)-5,5-dimethylimidazolidine-2,4-dione. InChIKey: MQGFAZCFOADYND-UHFFFAOYSA-N.
| Molecular formula | C7H11BrN2O2 |
|---|---|
| Molecular weight | 235.08 g/mol |
| IUPAC name | 3-(2-bromoethyl)-5,5-dimethylimidazolidine-2,4-dione |
| InChIKey | MQGFAZCFOADYND-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)N(C(=O)N1)CCBr)C |
Computed by PubChem (NCBI)