CAS 159135-61-2 appears in our catalog under these names: 3-Bromomethyl-1,5,5-trimethylhydantoin, 95%, 3-(Bromomethyl)-1,5,5-trimethylimidazolidine-2,4-dione, 95+%, 3-BROMOMETHYL-1,5,5-TRIMETHYLHYDANTOIN, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
3-(bromomethyl)-1,5,5-trimethylimidazolidine-2,4-dione (CAS 159135-61-2) is a chemical compound with the molecular formula C7H11BrN2O2 and a molecular weight of 235.08 g/mol. IUPAC name: 3-(bromomethyl)-1,5,5-trimethylimidazolidine-2,4-dione. InChIKey: BBKDOFXVZYMKAC-UHFFFAOYSA-N.
| Molecular formula | C7H11BrN2O2 |
|---|---|
| Molecular weight | 235.08 g/mol |
| IUPAC name | 3-(bromomethyl)-1,5,5-trimethylimidazolidine-2,4-dione |
| InChIKey | BBKDOFXVZYMKAC-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)N(C(=O)N1C)CBr)C |
Computed by PubChem (NCBI)