CAS 13279-58-8 is the registry number for 4-Chlorosulfonyl-2,5-dimethoxyacetanilide. Offered by: TRC. Available pack sizes: 5g.
4-acetamido-2,5-dimethoxybenzenesulfonyl chloride (CAS 13279-58-8) is a chemical compound with the molecular formula C10H12ClNO5S and a molecular weight of 293.72 g/mol. IUPAC name: 4-acetamido-2,5-dimethoxybenzenesulfonyl chloride. InChIKey: QMJIZLZFBGRSAS-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO5S |
|---|---|
| Molecular weight | 293.72 g/mol |
| IUPAC name | 4-acetamido-2,5-dimethoxybenzenesulfonyl chloride |
| InChIKey | QMJIZLZFBGRSAS-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1OC)S(=O)(=O)Cl)OC |
Computed by PubChem (NCBI)