Products 1858251-89-4

CAS 1858251-89-4 is the registry number for N-(2-Chloro-5-methoxyphenyl)-n-(methylsulfonyl)glycine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(2-chloro-5-methoxy-N-methylsulfonylanilino)acetic acid (CAS 1858251-89-4) is a chemical compound with the molecular formula C10H12ClNO5S and a molecular weight of 293.72 g/mol. IUPAC name: 2-(2-chloro-5-methoxy-N-methylsulfonylanilino)acetic acid. InChIKey: ZJOZSBVACQDHKI-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12ClNO5S
Molecular weight293.72 g/mol
IUPAC name2-(2-chloro-5-methoxy-N-methylsulfonylanilino)acetic acid
InChIKeyZJOZSBVACQDHKI-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1)Cl)N(CC(=O)O)S(=O)(=O)C

Computed by PubChem (NCBI)