CAS 13288-70-5 appears in our catalog under these names: Bis(4-hydroxy-3,5-dimethylphenyl) sulfone, 98%, Bis(4-hydroxy-3,5-dimethylphenyl) Sulfone, >95% (HPLC), 4,4'-Sulfonylbis(2,6-dimethylphenol), 98%, Bis(4-hydroxy-3,5-dimethylphenyl) Sulfone. Offered by: Combi-blocks, TRC, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100g, 25g, 1g, 100mg, 250mg, 500mg, 5mg.
4-(4-hydroxy-3,5-dimethylphenyl)sulfonyl-2,6-dimethylphenol (CAS 13288-70-5) is a chemical compound with the molecular formula C16H18O4S and a molecular weight of 306.4 g/mol. IUPAC name: 4-(4-hydroxy-3,5-dimethylphenyl)sulfonyl-2,6-dimethylphenol. InChIKey: SUCTVKDVODFXFX-UHFFFAOYSA-N.
| Molecular formula | C16H18O4S |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | 4-(4-hydroxy-3,5-dimethylphenyl)sulfonyl-2,6-dimethylphenol |
| InChIKey | SUCTVKDVODFXFX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1O)C)S(=O)(=O)C2=CC(=C(C(=C2)C)O)C |
Computed by PubChem (NCBI)