CAS 4981-83-3 appears in our catalog under these names: 2-(Benzyloxyethyl) p-toluenesulfonate, 96%, Benzyl–PEG1–Tos, Benzyl-PEG1-Tos 95%, 2-(Benzyloxy)ethyl 4-methylbenzenesulfonate, 95%, 95%, Benzyl-PEG1-Tos. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10g, 1g, 5g, 250mg, 5 g, 250 mg, 1 g.
2-phenylmethoxyethyl 4-methylbenzenesulfonate (CAS 4981-83-3) is a chemical compound with the molecular formula C16H18O4S and a molecular weight of 306.4 g/mol. IUPAC name: 2-phenylmethoxyethyl 4-methylbenzenesulfonate. InChIKey: HFNFGZWMDNDYNJ-UHFFFAOYSA-N.
| Molecular formula | C16H18O4S |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | 2-phenylmethoxyethyl 4-methylbenzenesulfonate |
| InChIKey | HFNFGZWMDNDYNJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCC2=CC=CC=C2 |
Computed by PubChem (NCBI)