Products 132906-52-6
CAS 132906-52-6 appears in our catalog under these names: 8-Chloro-2,3,4,9-tetrahydro-1h-carbazol-1-one, 95%, 8-Chloro-2,3,4,9-tetrahydro-1H-carbazol-1-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 5g, 1g, 2,5g.
8-chloro-2,3,4,9-tetrahydrocarbazol-1-one (CAS 132906-52-6) is a chemical compound with the molecular formula C12H10ClNO and a molecular weight of 219.66 g/mol. IUPAC name: 8-chloro-2,3,4,9-tetrahydrocarbazol-1-one. InChIKey: WBXRAOUSCYEKQO-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | 8-chloro-2,3,4,9-tetrahydrocarbazol-1-one |
| InChIKey | WBXRAOUSCYEKQO-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)C1)NC3=C2C=CC=C3Cl |
Computed by PubChem (NCBI)