Products 132928-46-2
CAS 132928-46-2 is the registry number for PF-10040. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[2-(3,4-dimethoxyphenyl)ethyl]-6-methyl-3,4-dihydroisoquinoline;hydrochloride (CAS 132928-46-2) is a chemical compound with the molecular formula C20H24ClNO2 and a molecular weight of 345.9 g/mol. IUPAC name: 1-[2-(3,4-dimethoxyphenyl)ethyl]-6-methyl-3,4-dihydroisoquinoline;hydrochloride. InChIKey: FJHOALINTTUIKP-UHFFFAOYSA-N.
| Molecular formula | C20H24ClNO2 |
|---|---|
| Molecular weight | 345.9 g/mol |
| IUPAC name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-6-methyl-3,4-dihydroisoquinoline;hydrochloride |
| InChIKey | FJHOALINTTUIKP-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=NCC2)CCC3=CC(=C(C=C3)OC)OC.Cl |
Computed by PubChem (NCBI)