Products 2829929-68-0
CAS 2829929-68-0 is the registry number for tert-Butyl (R)-(1-([1,1'-biphenyl]-4-yl)-3-chloropropan-2-yl)carbamate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(2R)-1-chloro-3-(4-phenylphenyl)propan-2-yl]carbamate (CAS 2829929-68-0) is a chemical compound with the molecular formula C20H24ClNO2 and a molecular weight of 345.9 g/mol. IUPAC name: tert-butyl N-[(2R)-1-chloro-3-(4-phenylphenyl)propan-2-yl]carbamate. InChIKey: QEIKEAVBXMICCN-GOSISDBHSA-N.
| Molecular formula | C20H24ClNO2 |
|---|---|
| Molecular weight | 345.9 g/mol |
| IUPAC name | tert-butyl N-[(2R)-1-chloro-3-(4-phenylphenyl)propan-2-yl]carbamate |
| InChIKey | QEIKEAVBXMICCN-GOSISDBHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=C(C=C1)C2=CC=CC=C2)CCl |
Computed by PubChem (NCBI)