CAS 132932-62-8 is the registry number for 1-(4-Benzo(b)thien-2-ylphenyl)ethanone. Offered by: Biosynth. Available pack sizes: 0,1g, 0,05g, 0,25g, 0,5g, 1g.
[4-(1-benzothiophen-2-yl)phenyl] acetate (CAS 132932-62-8) is a chemical compound with the molecular formula C16H12O2S and a molecular weight of 268.3 g/mol. IUPAC name: [4-(1-benzothiophen-2-yl)phenyl] acetate. InChIKey: DHRGTVQDDWWSMS-UHFFFAOYSA-N.
| Molecular formula | C16H12O2S |
|---|---|
| Molecular weight | 268.3 g/mol |
| IUPAC name | [4-(1-benzothiophen-2-yl)phenyl] acetate |
| InChIKey | DHRGTVQDDWWSMS-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=C(C=C1)C2=CC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)