CAS 35105-75-0 is the registry number for 1-{12-Acetyl-8-thiatricyclo(7.4.0.0,2,7)trideca-1(9),2(7),3,5,10,12-hexaen-4-yl}ethan-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(8-acetyldibenzothiophen-2-yl)ethanone (CAS 35105-75-0) is a chemical compound with the molecular formula C16H12O2S and a molecular weight of 268.3 g/mol. IUPAC name: 1-(8-acetyldibenzothiophen-2-yl)ethanone. InChIKey: VBPBWRXUZDIQHT-UHFFFAOYSA-N.
| Molecular formula | C16H12O2S |
|---|---|
| Molecular weight | 268.3 g/mol |
| IUPAC name | 1-(8-acetyldibenzothiophen-2-yl)ethanone |
| InChIKey | VBPBWRXUZDIQHT-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)SC3=C2C=C(C=C3)C(=O)C |
Computed by PubChem (NCBI)