CAS 13294-63-8 appears in our catalog under these names: 3-Chloro-1,1-diphenylpropan-2-one, 95%, 3-Chloro-1,1-diphenylpropan-2-one, 97%, 3–Chloro–1,1–Diphenylpropan–2–One. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 5g, 1g, 100mg.
3-chloro-1,1-diphenylpropan-2-one (CAS 13294-63-8) is a chemical compound with the molecular formula C15H13ClO and a molecular weight of 244.71 g/mol. IUPAC name: 3-chloro-1,1-diphenylpropan-2-one. InChIKey: FDKZWKIFDIVPDI-UHFFFAOYSA-N.
| Molecular formula | C15H13ClO |
|---|---|
| Molecular weight | 244.71 g/mol |
| IUPAC name | 3-chloro-1,1-diphenylpropan-2-one |
| InChIKey | FDKZWKIFDIVPDI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)CCl |
Computed by PubChem (NCBI)