CAS 1462937-60-5 appears in our catalog under these names: 4'-Chloro-2,6-dimethyl-[1,1'-biphenyl]-4-carbaldehyde, 95%, 4'-Chloro-2,6-dimethyl-[1,1'-biphenyl]-4-carbaldehyde. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
4-(4-chlorophenyl)-3,5-dimethylbenzaldehyde (CAS 1462937-60-5) is a chemical compound with the molecular formula C15H13ClO and a molecular weight of 244.71 g/mol. IUPAC name: 4-(4-chlorophenyl)-3,5-dimethylbenzaldehyde. InChIKey: QENYYEAIWOXAAK-UHFFFAOYSA-N.
| Molecular formula | C15H13ClO |
|---|---|
| Molecular weight | 244.71 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-3,5-dimethylbenzaldehyde |
| InChIKey | QENYYEAIWOXAAK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C2=CC=C(C=C2)Cl)C)C=O |
Computed by PubChem (NCBI)