CAS 1329496-63-0 appears in our catalog under these names: Maprotiline-d3 HCl, Maprotiline–d3 (hydrochloride), Maprotiline-d3 hydrochloride, Maprotiline-d3 (hydrochloride), 98%, 98%, Maprotiline-d3 (hydrochloride), 98.80%. Offered by: Chemat Brand, GLPBio, TargetMol, Biosynth, Chemat. Available pack sizes: on request, 1mg, 5mg, 10mg, 25mg, 50mg, 1 mg, 5 mg.
3-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)-N-(trideuteriomethyl)propan-1-amine;hydrochloride (CAS 1329496-63-0) is a chemical compound with the molecular formula C20H24ClN and a molecular weight of 316.9 g/mol. IUPAC name: 3-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)-N-(trideuteriomethyl)propan-1-amine;hydrochloride. InChIKey: NZDMFGKECODQRY-NIIDSAIPSA-N.
| Molecular formula | C20H24ClN |
|---|---|
| Molecular weight | 316.9 g/mol |
| IUPAC name | 3-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)-N-(trideuteriomethyl)propan-1-amine;hydrochloride |
| InChIKey | NZDMFGKECODQRY-NIIDSAIPSA-N |
| SMILES | [2H]C([2H])([2H])NCCCC12CCC(C3=CC=CC=C31)C4=CC=CC=C24.Cl |
Computed by PubChem (NCBI)