Products 203645-63-0
CAS 203645-63-0 appears in our catalog under these names: Amitriptyline-d6 HCl, Amitriptyline-d6 Hydrochloride, >95% (HPLC), Amitriptyline-d6 HCl (N,N-dimethyl-d6), 99 atom % D, min 98% Chemical Purity, Amitriptyline–d6 hydrochloride, Amitriptyline-d6 (hydrochloride), 99.93%. Offered by: Chemat Brand, TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: on request, 1mg, 2,5mg, 5mg, 0,05g, 0,01g, 1 mg, 5 mg.
3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)-N,N-bis(trideuteriomethyl)propan-1-amine;hydrochloride (CAS 203645-63-0) is a chemical compound with the molecular formula C20H24ClN and a molecular weight of 319.9 g/mol. IUPAC name: 3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)-N,N-bis(trideuteriomethyl)propan-1-amine;hydrochloride. InChIKey: KFYRPLNVJVHZGT-TXHXQZCNSA-N.
| Molecular formula | C20H24ClN |
|---|---|
| Molecular weight | 319.9 g/mol |
| IUPAC name | 3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)-N,N-bis(trideuteriomethyl)propan-1-amine;hydrochloride |
| InChIKey | KFYRPLNVJVHZGT-TXHXQZCNSA-N |
| SMILES | [2H]C([2H])([2H])N(CCC=C1C2=CC=CC=C2CCC3=CC=CC=C31)C([2H])([2H])[2H].Cl |
Computed by PubChem (NCBI)