Products 1329569-04-1

CAS 1329569-04-1 is the registry number for 2-Vanillin-d3. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

2-hydroxy-3-(trideuteriomethoxy)benzaldehyde (CAS 1329569-04-1) is a chemical compound with the molecular formula C8H8O3 and a molecular weight of 155.17 g/mol. IUPAC name: 2-hydroxy-3-(trideuteriomethoxy)benzaldehyde. InChIKey: JJVNINGBHGBWJH-FIBGUPNXSA-N.

Identity
Molecular formulaC8H8O3
Molecular weight155.17 g/mol
IUPAC name2-hydroxy-3-(trideuteriomethoxy)benzaldehyde
InChIKeyJJVNINGBHGBWJH-FIBGUPNXSA-N
SMILES[2H]C([2H])([2H])OC1=CC=CC(=C1O)C=O

Computed by PubChem (NCBI)

Synonyms: 2-Vanillin-d3