CAS 1329569-04-1 is the registry number for 2-Vanillin-d3. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
2-hydroxy-3-(trideuteriomethoxy)benzaldehyde (CAS 1329569-04-1) is a chemical compound with the molecular formula C8H8O3 and a molecular weight of 155.17 g/mol. IUPAC name: 2-hydroxy-3-(trideuteriomethoxy)benzaldehyde. InChIKey: JJVNINGBHGBWJH-FIBGUPNXSA-N.
| Molecular formula | C8H8O3 |
|---|---|
| Molecular weight | 155.17 g/mol |
| IUPAC name | 2-hydroxy-3-(trideuteriomethoxy)benzaldehyde |
| InChIKey | JJVNINGBHGBWJH-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC=CC(=C1O)C=O |
Computed by PubChem (NCBI)