CAS 1329613-90-2 appears in our catalog under these names: Diethyl Phosphate-13C4 Sodium Salt, >95% (HPLC), Diethyl phosphate-13C4 sodium salt, Diethyl phosphate-13C4 (sodium). Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 2mg, 5mg, 1 mg.
Sodium di(1,2-13C2)ethyl phosphate (CAS 1329613-90-2) is a chemical compound with the molecular formula C4H10NaO4P and a molecular weight of 180.05 g/mol. IUPAC name: sodium di(1,2-13C2)ethyl phosphate. InChIKey: GUCVHDYRKMSBOJ-UJNKEPEOSA-M.
| Molecular formula | C4H10NaO4P |
|---|---|
| Molecular weight | 180.05 g/mol |
| IUPAC name | sodium di(1,2-13C2)ethyl phosphate |
| InChIKey | GUCVHDYRKMSBOJ-UJNKEPEOSA-M |
| SMILES | [13CH3][13CH2]OP(=O)([O-])O[13CH2][13CH3].[Na+] |
Computed by PubChem (NCBI)