CAS 2517378-93-5 appears in our catalog under these names: O,O-Di(Ethyl-d5)phosphate Sodium Salt, >95% (HPLC), Phosphoric acid, diethyl ester-d10 (sodium salt). Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 25 mg, 2.5 mg.
Sodium bis(1,1,2,2,2-pentadeuterioethyl) phosphate (CAS 2517378-93-5) is a chemical compound with the molecular formula C4H10NaO4P and a molecular weight of 186.14 g/mol. IUPAC name: sodium bis(1,1,2,2,2-pentadeuterioethyl) phosphate. InChIKey: GUCVHDYRKMSBOJ-MFMGRUKYSA-M.
| Molecular formula | C4H10NaO4P |
|---|---|
| Molecular weight | 186.14 g/mol |
| IUPAC name | sodium bis(1,1,2,2,2-pentadeuterioethyl) phosphate |
| InChIKey | GUCVHDYRKMSBOJ-MFMGRUKYSA-M |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OP(=O)([O-])OC([2H])([2H])C([2H])([2H])[2H].[Na+] |
Computed by PubChem (NCBI)