CAS 1329799-67-8 appears in our catalog under these names: 2-Pyridylacetic Acid-d6 HCl, 2-Pyridylacetic Acid-d6 Hydrochloride (d5 Major), >95% (HPLC), 2-(Pyridin-2-yl)acetic acid-d6 (hydrochloride). Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 1 mg, 10 mg.
2,2-dideuterio-2-(3,4,5,6-tetradeuterio-2-pyridinyl)acetic acid;hydrochloride (CAS 1329799-67-8) is a chemical compound with the molecular formula C7H8ClNO2 and a molecular weight of 179.63 g/mol. IUPAC name: 2,2-dideuterio-2-(3,4,5,6-tetradeuterio-2-pyridinyl)acetic acid;hydrochloride. InChIKey: MQVISALTZUNQSK-UNJHBGEESA-N.
| Molecular formula | C7H8ClNO2 |
|---|---|
| Molecular weight | 179.63 g/mol |
| IUPAC name | 2,2-dideuterio-2-(3,4,5,6-tetradeuterio-2-pyridinyl)acetic acid;hydrochloride |
| InChIKey | MQVISALTZUNQSK-UNJHBGEESA-N |
| SMILES | [2H]C1=C(C(=NC(=C1[2H])C([2H])([2H])C(=O)O)[2H])[2H].Cl |
Computed by PubChem (NCBI)