Products 1219802-51-3
CAS 1219802-51-3 appears in our catalog under these names: 2-Pyridylacetic-alpha,alpha-d2 Acid-OD DCl, 98 atom % D, min 98% Chemical Purity, 2-(Pyridin-2-yl)acetic acid-d2 (hydrochloride). Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 1 mg.
(2H)chlorane;deuterio 2,2-dideuterio-2-pyridin-2-ylacetate (CAS 1219802-51-3) is a chemical compound with the molecular formula C7H8ClNO2 and a molecular weight of 177.62 g/mol. IUPAC name: (2H)chlorane;deuterio 2,2-dideuterio-2-pyridin-2-ylacetate. InChIKey: MQVISALTZUNQSK-LFWFLCBASA-N.
| Molecular formula | C7H8ClNO2 |
|---|---|
| Molecular weight | 177.62 g/mol |
| IUPAC name | (2H)chlorane;deuterio 2,2-dideuterio-2-pyridin-2-ylacetate |
| InChIKey | MQVISALTZUNQSK-LFWFLCBASA-N |
| SMILES | [2H]C([2H])(C1=CC=CC=N1)C(=O)O[2H].[2H]Cl |
Computed by PubChem (NCBI)